C11H12N2OS — CID 61284615
2-[(1,3-thiazol-2-ylmethylamino)methyl]phenol (PubChem CID 61284615) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-[(1,3-thiazol-2-ylmethylamino)methyl]phenol.
| Compound Name | 2-[(1,3-thiazol-2-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 61284615 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-[(1,3-thiazol-2-ylmethylamino)methyl]phenol |
| SMILES | Oc1ccccc1CNCc1nccs1 |
| InChI | InChI=1S/C11H12N2OS/c14-10-4-2-1-3-9(10)7-12-8-11-13-5-6-15-11/h1-6,12,14H,7-8H2 |
| InChIKey | LNWZRMMZKKWQGZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|