C12H14N2O3S — CID 107730832
4-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]benzene-1,2,3-triol (PubChem CID 107730832) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 107730832 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(CNCCc2nccs2)c(O)c1O |
| InChI | InChI=1S/C12H14N2O3S/c15-9-2-1-8(11(16)12(9)17)7-13-4-3-10-14-5-6-18-10/h1-2,5-6,13,15-17H,3-4,7H2 |
| InChIKey | KSSKVZQLVRAGNG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|