C12H13FN2S — CID 62196333
N-[(4-fluorophenyl)methyl]-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 62196333) has the molecular formula C12H13FN2S and a molecular weight of 236.32 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 62196333 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | Fc1ccc(CNCCc2nccs2)cc1 |
| InChI | InChI=1S/C12H13FN2S/c13-11-3-1-10(2-4-11)9-14-6-5-12-15-7-8-16-12/h1-4,7-8,14H,5-6,9H2 |
| InChIKey | HVBXEIVYHOAYHV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|