C10H11BrN2S2 — CID 62198261
N-[(5-bromothiophen-3-yl)methyl]-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 62198261) has the molecular formula C10H11BrN2S2 and a molecular weight of 303.25 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 62198261 |
| Molecular Formula | C10H11BrN2S2 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | Brc1cc(CNCCc2nccs2)cs1 |
| InChI | InChI=1S/C10H11BrN2S2/c11-9-5-8(7-15-9)6-12-2-1-10-13-3-4-14-10/h3-5,7,12H,1-2,6H2 |
| InChIKey | DJSSARBTYKGHKR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|