About 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline
4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline (PubChem CID 115297731) has the molecular formula C12H14BrN3S
and a molecular weight of 312.24 g/mol. Its IUPAC name is 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline.
Molecular Properties
| Compound Name | 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline |
| PubChem CID | 115297731 |
| Molecular Formula | C12H14BrN3S |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline |
| SMILES | Nc1ccc(Br)c(CNCCc2nccs2)c1 |
| InChI | InChI=1S/C12H14BrN3S/c13-11-2-1-10(14)7-9(11)8-15-4-3-12-16-5-6-17-12/h1-2,5-7,15H,3-4,8,14H2 |
| InChIKey | KMQRVZWITYONDC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline?
The IUPAC name of 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline (CID 115297731) is 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline.
What is the SMILES notation for 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline?
The canonical SMILES for 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline is Nc1ccc(Br)c(CNCCc2nccs2)c1.
What is the InChIKey of 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline?
The InChIKey is KMQRVZWITYONDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN3S/c13-11-2-1-10(14)7-9(11)8-15-4-3-12-16-5-6-17-12/h1-2,5-7,15H,3-4,8,14H2.
What are the key properties of 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline?
4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline has a molecular weight of 312.24 g/mol, XLogP of 2.82, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]aniline is sourced from PubChem (CID 115297731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).