C9H11BrF2N2 — CID 115407534
4-bromo-3-[(2,2-difluoroethylamino)methyl]aniline (PubChem CID 115407534) has the molecular formula C9H11BrF2N2 and a molecular weight of 265.10 g/mol. Its IUPAC name is 4-bromo-3-[(2,2-difluoroethylamino)methyl]aniline.
| Compound Name | 4-bromo-3-[(2,2-difluoroethylamino)methyl]aniline |
|---|---|
| PubChem CID | 115407534 |
| Molecular Formula | C9H11BrF2N2 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 4-bromo-3-[(2,2-difluoroethylamino)methyl]aniline |
| SMILES | Nc1ccc(Br)c(CNCC(F)F)c1 |
| InChI | InChI=1S/C9H11BrF2N2/c10-8-2-1-7(13)3-6(8)4-14-5-9(11)12/h1-3,9,14H,4-5,13H2 |
| InChIKey | PLIWDSCIJPJDRX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|