C11H14BrF3N2 — CID 115520237
4-bromo-3-[(4,4,4-trifluorobutylamino)methyl]aniline (PubChem CID 115520237) has the molecular formula C11H14BrF3N2 and a molecular weight of 311.14 g/mol. Its IUPAC name is 4-bromo-3-[(4,4,4-trifluorobutylamino)methyl]aniline.
| Compound Name | 4-bromo-3-[(4,4,4-trifluorobutylamino)methyl]aniline |
|---|---|
| PubChem CID | 115520237 |
| Molecular Formula | C11H14BrF3N2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-bromo-3-[(4,4,4-trifluorobutylamino)methyl]aniline |
| SMILES | Nc1ccc(Br)c(CNCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14BrF3N2/c12-10-3-2-9(16)6-8(10)7-17-5-1-4-11(13,14)15/h2-3,6,17H,1,4-5,7,16H2 |
| InChIKey | MXZPSFFAYRYTSK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|