C11H14F3NO2 — CID 79039995
4-[(4,4,4-trifluorobutylamino)methyl]benzene-1,3-diol (PubChem CID 79039995) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4-[(4,4,4-trifluorobutylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(4,4,4-trifluorobutylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 79039995 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-[(4,4,4-trifluorobutylamino)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNCCCC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C11H14F3NO2/c12-11(13,14)4-1-5-15-7-8-2-3-9(16)6-10(8)17/h2-3,6,15-17H,1,4-5,7H2 |
| InChIKey | BIGSTYLUPLPFHH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|