C13H21NO3 — CID 28726669
4-[(3-propan-2-yloxypropylamino)methyl]benzene-1,3-diol (PubChem CID 28726669) has the molecular formula C13H21NO3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-[(3-propan-2-yloxypropylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(3-propan-2-yloxypropylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 28726669 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[(3-propan-2-yloxypropylamino)methyl]benzene-1,3-diol |
| SMILES | CC(C)OCCCNCc1ccc(O)cc1O |
| InChI | InChI=1S/C13H21NO3/c1-10(2)17-7-3-6-14-9-11-4-5-12(15)8-13(11)16/h4-5,8,10,14-16H,3,6-7,9H2,1-2H3 |
| InChIKey | NSWVIRZZJDPFCK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|