C12H19NO3 — CID 107267932
4-[(4-hydroxypentylamino)methyl]benzene-1,3-diol (PubChem CID 107267932) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-[(4-hydroxypentylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(4-hydroxypentylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107267932 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 4-[(4-hydroxypentylamino)methyl]benzene-1,3-diol |
| SMILES | CC(O)CCCNCc1ccc(O)cc1O |
| InChI | InChI=1S/C12H19NO3/c1-9(14)3-2-6-13-8-10-4-5-11(15)7-12(10)16/h4-5,7,9,13-16H,2-3,6,8H2,1H3 |
| InChIKey | CDHQZYPBIPLYOX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|