C14H23NO — CID 107267917
5-[(2,4-dimethylphenyl)methylamino]pentan-2-ol (PubChem CID 107267917) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenyl)methylamino]pentan-2-ol.
| Compound Name | 5-[(2,4-dimethylphenyl)methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 107267917 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 5-[(2,4-dimethylphenyl)methylamino]pentan-2-ol |
| SMILES | Cc1ccc(CNCCCC(C)O)c(C)c1 |
| InChI | InChI=1S/C14H23NO/c1-11-6-7-14(12(2)9-11)10-15-8-4-5-13(3)16/h6-7,9,13,15-16H,4-5,8,10H2,1-3H3 |
| InChIKey | OTWFXYBCJCTFKZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|