C13H18N2 — CID 115231662
4-[(2,4-dimethylphenyl)methylamino]butanenitrile (PubChem CID 115231662) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenyl)methylamino]butanenitrile.
| Compound Name | 4-[(2,4-dimethylphenyl)methylamino]butanenitrile |
|---|---|
| PubChem CID | 115231662 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-[(2,4-dimethylphenyl)methylamino]butanenitrile |
| SMILES | Cc1ccc(CNCCCC#N)c(C)c1 |
| InChI | InChI=1S/C13H18N2/c1-11-5-6-13(12(2)9-11)10-15-8-4-3-7-14/h5-6,9,15H,3-4,8,10H2,1-2H3 |
| InChIKey | RXGXJOKIGJDLDK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|