C16H27NO — CID 111467465
5-[(2,4-dimethylphenyl)methylamino]-2,2-dimethylpentan-1-ol (PubChem CID 111467465) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenyl)methylamino]-2,2-dimethylpentan-1-ol.
| Compound Name | 5-[(2,4-dimethylphenyl)methylamino]-2,2-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 111467465 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 5-[(2,4-dimethylphenyl)methylamino]-2,2-dimethylpentan-1-ol |
| SMILES | Cc1ccc(CNCCCC(C)(C)CO)c(C)c1 |
| InChI | InChI=1S/C16H27NO/c1-13-6-7-15(14(2)10-13)11-17-9-5-8-16(3,4)12-18/h6-7,10,17-18H,5,8-9,11-12H2,1-4H3 |
| InChIKey | QLBKYGGRKGGKSO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|