C14H21NO2 — CID 54920507
methyl 4-[(2,4-dimethylphenyl)methylamino]butanoate (PubChem CID 54920507) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is methyl 4-[(2,4-dimethylphenyl)methylamino]butanoate.
| Compound Name | methyl 4-[(2,4-dimethylphenyl)methylamino]butanoate |
|---|---|
| PubChem CID | 54920507 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | methyl 4-[(2,4-dimethylphenyl)methylamino]butanoate |
| SMILES | COC(=O)CCCNCc1ccc(C)cc1C |
| InChI | InChI=1S/C14H21NO2/c1-11-6-7-13(12(2)9-11)10-15-8-4-5-14(16)17-3/h6-7,9,15H,4-5,8,10H2,1-3H3 |
| InChIKey | SNOYVFFGRVURBP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|