methyl 2-[(2,5-dimethylphenyl)methylamino]acetate

C12H17NO2 — CID 60687577

IUPACmethyl 2-[(2,5-dimethylphenyl)methylamino]acetate
SMILESCOC(=O)CNCc1cc(C)ccc1C
InChIInChI=1S/C12H17NO2/c1-9-4-5-10(2)11(6-9)7-13-8-12(14)15-3/h4-6,13H,7-8H2,1-3H3
InChIKeyXYSVXHSJAIDUQH-UHFFFAOYSA-N
MW207.27 g/mol
LogP1.57
Rot. Bonds4

About methyl 2-[(2,5-dimethylphenyl)methylamino]acetate

methyl 2-[(2,5-dimethylphenyl)methylamino]acetate (PubChem CID 60687577) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is methyl 2-[(2,5-dimethylphenyl)methylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[(2,5-dimethylphenyl)methylamino]acetate
PubChem CID60687577
Molecular FormulaC12H17NO2
Molecular Weight207.27 g/mol
Exact Mass207.13
IUPAC Namemethyl 2-[(2,5-dimethylphenyl)methylamino]acetate
SMILESCOC(=O)CNCc1cc(C)ccc1C
InChIInChI=1S/C12H17NO2/c1-9-4-5-10(2)11(6-9)7-13-8-12(14)15-3/h4-6,13H,7-8H2,1-3H3
InChIKeyXYSVXHSJAIDUQH-UHFFFAOYSA-N
XLogP1.57
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.27
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(2,5-dimethylphenyl)methylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,5-dimethylphenyl)methylamino]acetate?
The IUPAC name of methyl 2-[(2,5-dimethylphenyl)methylamino]acetate (CID 60687577) is methyl 2-[(2,5-dimethylphenyl)methylamino]acetate.
What is the SMILES notation for methyl 2-[(2,5-dimethylphenyl)methylamino]acetate?
The canonical SMILES for methyl 2-[(2,5-dimethylphenyl)methylamino]acetate is COC(=O)CNCc1cc(C)ccc1C.
What is the InChIKey of methyl 2-[(2,5-dimethylphenyl)methylamino]acetate?
The InChIKey is XYSVXHSJAIDUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-9-4-5-10(2)11(6-9)7-13-8-12(14)15-3/h4-6,13H,7-8H2,1-3H3.
What are the key properties of methyl 2-[(2,5-dimethylphenyl)methylamino]acetate?
methyl 2-[(2,5-dimethylphenyl)methylamino]acetate has a molecular weight of 207.27 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,5-dimethylphenyl)methylamino]acetate is sourced from PubChem (CID 60687577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).