methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate

C13H19NO3 — CID 115232862

IUPACmethyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate
SMILESCOC(=O)CNCc1cc(C)c(OC)cc1C
InChIInChI=1S/C13H19NO3/c1-9-6-12(16-3)10(2)5-11(9)7-14-8-13(15)17-4/h5-6,14H,7-8H2,1-4H3
InChIKeyPDYPSYINYSHSFB-UHFFFAOYSA-N
MW237.30 g/mol
LogP1.57
Rot. Bonds5

About methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate

methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate (PubChem CID 115232862) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate
PubChem CID115232862
Molecular FormulaC13H19NO3
Molecular Weight237.30 g/mol
Exact Mass237.14
IUPAC Namemethyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate
SMILESCOC(=O)CNCc1cc(C)c(OC)cc1C
InChIInChI=1S/C13H19NO3/c1-9-6-12(16-3)10(2)5-11(9)7-14-8-13(15)17-4/h5-6,14H,7-8H2,1-4H3
InChIKeyPDYPSYINYSHSFB-UHFFFAOYSA-N
XLogP1.57
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate?
The IUPAC name of methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate (CID 115232862) is methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate.
What is the SMILES notation for methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate?
The canonical SMILES for methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate is COC(=O)CNCc1cc(C)c(OC)cc1C.
What is the InChIKey of methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate?
The InChIKey is PDYPSYINYSHSFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-9-6-12(16-3)10(2)5-11(9)7-14-8-13(15)17-4/h5-6,14H,7-8H2,1-4H3.
What are the key properties of methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate?
methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate has a molecular weight of 237.30 g/mol, XLogP of 1.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-methoxy-2,5-dimethylphenyl)methylamino]acetate is sourced from PubChem (CID 115232862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).