C13H19NO2 — CID 60694757
methyl 4-[(3-methylphenyl)methylamino]butanoate (PubChem CID 60694757) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is methyl 4-[(3-methylphenyl)methylamino]butanoate.
| Compound Name | methyl 4-[(3-methylphenyl)methylamino]butanoate |
|---|---|
| PubChem CID | 60694757 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | methyl 4-[(3-methylphenyl)methylamino]butanoate |
| SMILES | COC(=O)CCCNCc1cccc(C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-11-5-3-6-12(9-11)10-14-8-4-7-13(15)16-2/h3,5-6,9,14H,4,7-8,10H2,1-2H3 |
| InChIKey | ZNNZSJHKTPUVSW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|