C15H22N2 — CID 115231720
4-[(2-methyl-5-propan-2-ylphenyl)methylamino]butanenitrile (PubChem CID 115231720) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 4-[(2-methyl-5-propan-2-ylphenyl)methylamino]butanenitrile.
| Compound Name | 4-[(2-methyl-5-propan-2-ylphenyl)methylamino]butanenitrile |
|---|---|
| PubChem CID | 115231720 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 4-[(2-methyl-5-propan-2-ylphenyl)methylamino]butanenitrile |
| SMILES | Cc1ccc(C(C)C)cc1CNCCCC#N |
| InChI | InChI=1S/C15H22N2/c1-12(2)14-7-6-13(3)15(10-14)11-17-9-5-4-8-16/h6-7,10,12,17H,4-5,9,11H2,1-3H3 |
| InChIKey | CJSUTNPMDJALOP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|