C12H18ClNO — CID 106862742
4-[(2-chloro-4-methylphenyl)methylamino]butan-2-ol (PubChem CID 106862742) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is 4-[(2-chloro-4-methylphenyl)methylamino]butan-2-ol.
| Compound Name | 4-[(2-chloro-4-methylphenyl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 106862742 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-[(2-chloro-4-methylphenyl)methylamino]butan-2-ol |
| SMILES | Cc1ccc(CNCCC(C)O)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClNO/c1-9-3-4-11(12(13)7-9)8-14-6-5-10(2)15/h3-4,7,10,14-15H,5-6,8H2,1-2H3 |
| InChIKey | OLZHQPVBFUIIKV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|