C12H19ClN2 — CID 106861235
N'-[(2-chloro-4-methylphenyl)methyl]-N-methylpropane-1,3-diamine (PubChem CID 106861235) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N'-[(2-chloro-4-methylphenyl)methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[(2-chloro-4-methylphenyl)methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106861235 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N'-[(2-chloro-4-methylphenyl)methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1ccc(C)cc1Cl |
| InChI | InChI=1S/C12H19ClN2/c1-10-4-5-11(12(13)8-10)9-15-7-3-6-14-2/h4-5,8,14-15H,3,6-7,9H2,1-2H3 |
| InChIKey | UBVPBODAJARIQL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|