C10H12ClNO2 — CID 106865112
2-[(2-chloro-4-methylphenyl)methylamino]acetic acid (PubChem CID 106865112) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 2-[(2-chloro-4-methylphenyl)methylamino]acetic acid.
| Compound Name | 2-[(2-chloro-4-methylphenyl)methylamino]acetic acid |
|---|---|
| PubChem CID | 106865112 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-[(2-chloro-4-methylphenyl)methylamino]acetic acid |
| SMILES | Cc1ccc(CNCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO2/c1-7-2-3-8(9(11)4-7)5-12-6-10(13)14/h2-4,12H,5-6H2,1H3,(H,13,14) |
| InChIKey | RZSAQZSXQUAJKP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |