C12H16F3NO2 — CID 113321749
4-[(5,5,5-trifluoropentylamino)methyl]benzene-1,3-diol (PubChem CID 113321749) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-[(5,5,5-trifluoropentylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(5,5,5-trifluoropentylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 113321749 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-[(5,5,5-trifluoropentylamino)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNCCCCC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C12H16F3NO2/c13-12(14,15)5-1-2-6-16-8-9-3-4-10(17)7-11(9)18/h3-4,7,16-18H,1-2,5-6,8H2 |
| InChIKey | NFLWCLWKPORZRG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|