C11H17NO3 — CID 102696377
4-[(2-methoxypropylamino)methyl]benzene-1,3-diol (PubChem CID 102696377) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-[(2-methoxypropylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(2-methoxypropylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 102696377 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-[(2-methoxypropylamino)methyl]benzene-1,3-diol |
| SMILES | COC(C)CNCc1ccc(O)cc1O |
| InChI | InChI=1S/C11H17NO3/c1-8(15-2)6-12-7-9-3-4-10(13)5-11(9)14/h3-5,8,12-14H,6-7H2,1-2H3 |
| InChIKey | KOCREDVSQHQIAV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|