C10H15NO4 — CID 66176106
4-[(2,3-dihydroxypropylamino)methyl]benzene-1,3-diol (PubChem CID 66176106) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 4-[(2,3-dihydroxypropylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(2,3-dihydroxypropylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 66176106 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-[(2,3-dihydroxypropylamino)methyl]benzene-1,3-diol |
| SMILES | OCC(O)CNCc1ccc(O)cc1O |
| InChI | InChI=1S/C10H15NO4/c12-6-9(14)5-11-4-7-1-2-8(13)3-10(7)15/h1-3,9,11-15H,4-6H2 |
| InChIKey | VVRWQINGNFAGCO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|