C10H14ClNO2 — CID 57229220
3-[(2-chlorophenyl)methylamino]propane-1,2-diol (PubChem CID 57229220) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(2-chlorophenyl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 57229220 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-[(2-chlorophenyl)methylamino]propane-1,2-diol |
| SMILES | OCC(O)CNCc1ccccc1Cl |
| InChI | InChI=1S/C10H14ClNO2/c11-10-4-2-1-3-8(10)5-12-6-9(14)7-13/h1-4,9,12-14H,5-7H2 |
| InChIKey | XSOOFYFNOVKXFX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |