C11H14F3NO3 — CID 60703872
3-[[2-(trifluoromethoxy)phenyl]methylamino]propane-1,2-diol (PubChem CID 60703872) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is 3-[[2-(trifluoromethoxy)phenyl]methylamino]propane-1,2-diol.
| Compound Name | 3-[[2-(trifluoromethoxy)phenyl]methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 60703872 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-[[2-(trifluoromethoxy)phenyl]methylamino]propane-1,2-diol |
| SMILES | OCC(O)CNCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO3/c12-11(13,14)18-10-4-2-1-3-8(10)5-15-6-9(17)7-16/h1-4,9,15-17H,5-7H2 |
| InChIKey | FGPLABOEXIUWMU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |