C16H13F6NO2 — CID 112803590
1-[2-(trifluoromethoxy)phenyl]-N-[[2-(trifluoromethoxy)phenyl]methyl]methanamine (PubChem CID 112803590) has the molecular formula C16H13F6NO2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 1-[2-(trifluoromethoxy)phenyl]-N-[[2-(trifluoromethoxy)phenyl]methyl]methanamine.
| Compound Name | 1-[2-(trifluoromethoxy)phenyl]-N-[[2-(trifluoromethoxy)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 112803590 |
| Molecular Formula | C16H13F6NO2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-[2-(trifluoromethoxy)phenyl]-N-[[2-(trifluoromethoxy)phenyl]methyl]methanamine |
| SMILES | FC(F)(F)Oc1ccccc1CNCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H13F6NO2/c17-15(18,19)24-13-7-3-1-5-11(13)9-23-10-12-6-2-4-8-14(12)25-16(20,21)22/h1-8,23H,9-10H2 |
| InChIKey | SODGGZUFMQDYFX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |