C14H20F3NO2 — CID 103924217
6-[[2-(trifluoromethoxy)phenyl]methylamino]hexan-1-ol (PubChem CID 103924217) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 6-[[2-(trifluoromethoxy)phenyl]methylamino]hexan-1-ol.
| Compound Name | 6-[[2-(trifluoromethoxy)phenyl]methylamino]hexan-1-ol |
|---|---|
| PubChem CID | 103924217 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 6-[[2-(trifluoromethoxy)phenyl]methylamino]hexan-1-ol |
| SMILES | OCCCCCCNCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H20F3NO2/c15-14(16,17)20-13-8-4-3-7-12(13)11-18-9-5-1-2-6-10-19/h3-4,7-8,18-19H,1-2,5-6,9-11H2 |
| InChIKey | SMZPFVYVJACZSO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|