C13H18F3NOS — CID 115639279
4-methylsulfanyl-N-[[2-(trifluoromethoxy)phenyl]methyl]butan-1-amine (PubChem CID 115639279) has the molecular formula C13H18F3NOS and a molecular weight of 293.35 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[[2-(trifluoromethoxy)phenyl]methyl]butan-1-amine.
| Compound Name | 4-methylsulfanyl-N-[[2-(trifluoromethoxy)phenyl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 115639279 |
| Molecular Formula | C13H18F3NOS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 4-methylsulfanyl-N-[[2-(trifluoromethoxy)phenyl]methyl]butan-1-amine |
| SMILES | CSCCCCNCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H18F3NOS/c1-19-9-5-4-8-17-10-11-6-2-3-7-12(11)18-13(14,15)16/h2-3,6-7,17H,4-5,8-10H2,1H3 |
| InChIKey | DSXWCIVSTRDMPJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|