C11H17N3O3 — CID 77113883
2-[(2,3-dihydroxypropylamino)methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 77113883) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-[(2,3-dihydroxypropylamino)methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[(2,3-dihydroxypropylamino)methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77113883 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-[(2,3-dihydroxypropylamino)methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccccc1CNCC(O)CO |
| InChI | InChI=1S/C11H17N3O3/c12-11(14-17)10-4-2-1-3-8(10)5-13-6-9(16)7-15/h1-4,9,13,15-17H,5-7H2,(H2,12,14) |
| InChIKey | YKJYYBHCVNJIHB-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|