C15H15F2N3O — CID 77027172
2-[[(2,4-difluorophenyl)methylamino]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 77027172) has the molecular formula C15H15F2N3O and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-[[(2,4-difluorophenyl)methylamino]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[[(2,4-difluorophenyl)methylamino]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77027172 |
| Molecular Formula | C15H15F2N3O |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[[(2,4-difluorophenyl)methylamino]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccccc1CNCc1ccc(F)cc1F |
| InChI | InChI=1S/C15H15F2N3O/c16-12-6-5-11(14(17)7-12)9-19-8-10-3-1-2-4-13(10)15(18)20-21/h1-7,19,21H,8-9H2,(H2,18,20) |
| InChIKey | UAFACEXCMQAXMY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|