C11H14F3N3O — CID 77030623
N'-hydroxy-2-[(3,3,3-trifluoropropylamino)methyl]benzenecarboximidamide (PubChem CID 77030623) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is N'-hydroxy-2-[(3,3,3-trifluoropropylamino)methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-[(3,3,3-trifluoropropylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 77030623 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N'-hydroxy-2-[(3,3,3-trifluoropropylamino)methyl]benzenecarboximidamide |
| SMILES | NC(=NO)c1ccccc1CNCCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)5-6-16-7-8-3-1-2-4-9(8)10(15)17-18/h1-4,16,18H,5-7H2,(H2,15,17) |
| InChIKey | ZNGILWGMIVEXKN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|