C11H17N3O — CID 77028736
N'-hydroxy-2-(propylaminomethyl)benzenecarboximidamide (PubChem CID 77028736) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is N'-hydroxy-2-(propylaminomethyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-(propylaminomethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 77028736 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N'-hydroxy-2-(propylaminomethyl)benzenecarboximidamide |
| SMILES | CCCNCc1ccccc1C(N)=NO |
| InChI | InChI=1S/C11H17N3O/c1-2-7-13-8-9-5-3-4-6-10(9)11(12)14-15/h3-6,13,15H,2,7-8H2,1H3,(H2,12,14) |
| InChIKey | YXZGVMQMHYLMFF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|