C12H19N3O2 — CID 77025252
2-[(2-ethoxyethylamino)methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 77025252) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[(2-ethoxyethylamino)methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[(2-ethoxyethylamino)methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77025252 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[(2-ethoxyethylamino)methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCOCCNCc1ccccc1C(N)=NO |
| InChI | InChI=1S/C12H19N3O2/c1-2-17-8-7-14-9-10-5-3-4-6-11(10)12(13)15-16/h3-6,14,16H,2,7-9H2,1H3,(H2,13,15) |
| InChIKey | CXGAPOYZZTUYLM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|