C13H15N3OS — CID 77029595
N'-hydroxy-2-[(thiophen-2-ylmethylamino)methyl]benzenecarboximidamide (PubChem CID 77029595) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is N'-hydroxy-2-[(thiophen-2-ylmethylamino)methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-[(thiophen-2-ylmethylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 77029595 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N'-hydroxy-2-[(thiophen-2-ylmethylamino)methyl]benzenecarboximidamide |
| SMILES | NC(=NO)c1ccccc1CNCc1cccs1 |
| InChI | InChI=1S/C13H15N3OS/c14-13(16-17)12-6-2-1-4-10(12)8-15-9-11-5-3-7-18-11/h1-7,15,17H,8-9H2,(H2,14,16) |
| InChIKey | JYXYIXQJCJIFRE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|