C14H16FN3OS — CID 107116792
2-fluoro-N'-hydroxy-3-[(2-thiophen-2-ylethylamino)methyl]benzenecarboximidamide (PubChem CID 107116792) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-3-[(2-thiophen-2-ylethylamino)methyl]benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-3-[(2-thiophen-2-ylethylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107116792 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-fluoro-N'-hydroxy-3-[(2-thiophen-2-ylethylamino)methyl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1cccc(CNCCc2cccs2)c1F |
| InChI | InChI=1S/C14H16FN3OS/c15-13-10(3-1-5-12(13)14(16)18-19)9-17-7-6-11-4-2-8-20-11/h1-5,8,17,19H,6-7,9H2,(H2,16,18) |
| InChIKey | GJDGDFYYGDUTSQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|