C13H15N5O — CID 106896370
N'-hydroxy-2-[(pyridazin-3-ylmethylamino)methyl]benzenecarboximidamide (PubChem CID 106896370) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is N'-hydroxy-2-[(pyridazin-3-ylmethylamino)methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-[(pyridazin-3-ylmethylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106896370 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N'-hydroxy-2-[(pyridazin-3-ylmethylamino)methyl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccccc1CNCc1cccnn1 |
| InChI | InChI=1S/C13H15N5O/c14-13(18-19)12-6-2-1-4-10(12)8-15-9-11-5-3-7-16-17-11/h1-7,15,19H,8-9H2,(H2,14,18) |
| InChIKey | IKDGBFCBFKFHEA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|