C10H13BrClNO2 — CID 165476502
(2R)-3-[(2-bromo-5-chlorophenyl)methylamino]propane-1,2-diol (PubChem CID 165476502) has the molecular formula C10H13BrClNO2 and a molecular weight of 294.58 g/mol. Its IUPAC name is (2R)-3-[(2-bromo-5-chlorophenyl)methylamino]propane-1,2-diol.
| Compound Name | (2R)-3-[(2-bromo-5-chlorophenyl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 165476502 |
| Molecular Formula | C10H13BrClNO2 |
| Molecular Weight | 294.58 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | (2R)-3-[(2-bromo-5-chlorophenyl)methylamino]propane-1,2-diol |
| SMILES | OC[C@H](O)CNCc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C10H13BrClNO2/c11-10-2-1-8(12)3-7(10)4-13-5-9(15)6-14/h1-3,9,13-15H,4-6H2/t9-/m1/s1 |
| InChIKey | ZRYBWIBKGIIQLX-SECBINFHSA-N |
| XLogP | 1.55 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |