C10H13F2NO2 — CID 66174825
3-[(2,4-difluorophenyl)methylamino]propane-1,2-diol (PubChem CID 66174825) has the molecular formula C10H13F2NO2 and a molecular weight of 217.21 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(2,4-difluorophenyl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66174825 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methylamino]propane-1,2-diol |
| SMILES | OCC(O)CNCc1ccc(F)cc1F |
| InChI | InChI=1S/C10H13F2NO2/c11-8-2-1-7(10(12)3-8)4-13-5-9(15)6-14/h1-3,9,13-15H,4-6H2 |
| InChIKey | OAFWQMNJTFHTHW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |