C11H16ClNO4 — CID 113438661
3-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylamino]propane-1,2-diol (PubChem CID 113438661) has the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 113438661 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylamino]propane-1,2-diol |
| SMILES | COc1cc(Cl)cc(CNCC(O)CO)c1O |
| InChI | InChI=1S/C11H16ClNO4/c1-17-10-3-8(12)2-7(11(10)16)4-13-5-9(15)6-14/h2-3,9,13-16H,4-6H2,1H3 |
| InChIKey | QFSMGGCBIOBNNM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|