C14H11Cl4NO2 — CID 104663741
4-chloro-2-methoxy-6-[(2,4,5-trichloroanilino)methyl]phenol (PubChem CID 104663741) has the molecular formula C14H11Cl4NO2 and a molecular weight of 367.06 g/mol. Its IUPAC name is 4-chloro-2-methoxy-6-[(2,4,5-trichloroanilino)methyl]phenol.
| Compound Name | 4-chloro-2-methoxy-6-[(2,4,5-trichloroanilino)methyl]phenol |
|---|---|
| PubChem CID | 104663741 |
| Molecular Formula | C14H11Cl4NO2 |
| Molecular Weight | 367.06 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 4-chloro-2-methoxy-6-[(2,4,5-trichloroanilino)methyl]phenol |
| SMILES | COc1cc(Cl)cc(CNc2cc(Cl)c(Cl)cc2Cl)c1O |
| InChI | InChI=1S/C14H11Cl4NO2/c1-21-13-3-8(15)2-7(14(13)20)6-19-12-5-10(17)9(16)4-11(12)18/h2-5,19-20H,6H2,1H3 |
| InChIKey | IMAYJSUMJSGVFW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.06 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|