C15H15Cl2NO3 — CID 29274459
2,4-dichloro-6-[(2,4-dimethoxyanilino)methyl]phenol (PubChem CID 29274459) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.20 g/mol. Its IUPAC name is 2,4-dichloro-6-[(2,4-dimethoxyanilino)methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(2,4-dimethoxyanilino)methyl]phenol |
|---|---|
| PubChem CID | 29274459 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2,4-dichloro-6-[(2,4-dimethoxyanilino)methyl]phenol |
| SMILES | COc1ccc(NCc2cc(Cl)cc(Cl)c2O)c(OC)c1 |
| InChI | InChI=1S/C15H15Cl2NO3/c1-20-11-3-4-13(14(7-11)21-2)18-8-9-5-10(16)6-12(17)15(9)19/h3-7,18-19H,8H2,1-2H3 |
| InChIKey | IGBWOFGJGZWKCH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|