C15H15Cl2NO — CID 28540840
2,4-dichloro-6-[(2,4-dimethylanilino)methyl]phenol (PubChem CID 28540840) has the molecular formula C15H15Cl2NO and a molecular weight of 296.20 g/mol. Its IUPAC name is 2,4-dichloro-6-[(2,4-dimethylanilino)methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(2,4-dimethylanilino)methyl]phenol |
|---|---|
| PubChem CID | 28540840 |
| Molecular Formula | C15H15Cl2NO |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2,4-dichloro-6-[(2,4-dimethylanilino)methyl]phenol |
| SMILES | Cc1ccc(NCc2cc(Cl)cc(Cl)c2O)c(C)c1 |
| InChI | InChI=1S/C15H15Cl2NO/c1-9-3-4-14(10(2)5-9)18-8-11-6-12(16)7-13(17)15(11)19/h3-7,18-19H,8H2,1-2H3 |
| InChIKey | GJAADCSNQIGUDP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|