C16H17Cl2NO — CID 43687415
2,4-dichloro-6-[(2-propylanilino)methyl]phenol (PubChem CID 43687415) has the molecular formula C16H17Cl2NO and a molecular weight of 310.22 g/mol. Its IUPAC name is 2,4-dichloro-6-[(2-propylanilino)methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(2-propylanilino)methyl]phenol |
|---|---|
| PubChem CID | 43687415 |
| Molecular Formula | C16H17Cl2NO |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2,4-dichloro-6-[(2-propylanilino)methyl]phenol |
| SMILES | CCCc1ccccc1NCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H17Cl2NO/c1-2-5-11-6-3-4-7-15(11)19-10-12-8-13(17)9-14(18)16(12)20/h3-4,6-9,19-20H,2,5,10H2,1H3 |
| InChIKey | VAXOLOYHSCXOSM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|