C13H20ClNO3 — CID 104646127
4-chloro-2-methoxy-6-[(4-methoxybutylamino)methyl]phenol (PubChem CID 104646127) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 4-chloro-2-methoxy-6-[(4-methoxybutylamino)methyl]phenol.
| Compound Name | 4-chloro-2-methoxy-6-[(4-methoxybutylamino)methyl]phenol |
|---|---|
| PubChem CID | 104646127 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-chloro-2-methoxy-6-[(4-methoxybutylamino)methyl]phenol |
| SMILES | COCCCCNCc1cc(Cl)cc(OC)c1O |
| InChI | InChI=1S/C13H20ClNO3/c1-17-6-4-3-5-15-9-10-7-11(14)8-12(18-2)13(10)16/h7-8,15-16H,3-6,9H2,1-2H3 |
| InChIKey | DIDAHELMVPEWFJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|