C11H13BrF3NO — CID 113326981
2-bromo-4-[(4,4,4-trifluorobutylamino)methyl]phenol (PubChem CID 113326981) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 2-bromo-4-[(4,4,4-trifluorobutylamino)methyl]phenol.
| Compound Name | 2-bromo-4-[(4,4,4-trifluorobutylamino)methyl]phenol |
|---|---|
| PubChem CID | 113326981 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-bromo-4-[(4,4,4-trifluorobutylamino)methyl]phenol |
| SMILES | Oc1ccc(CNCCCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H13BrF3NO/c12-9-6-8(2-3-10(9)17)7-16-5-1-4-11(13,14)15/h2-3,6,16-17H,1,4-5,7H2 |
| InChIKey | LJNUHIHOXQYIDD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|