C13H18F3N — CID 79038802
N-[(4-ethylphenyl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 79038802) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[(4-ethylphenyl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 79038802 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | CCc1ccc(CNCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3N/c1-2-11-4-6-12(7-5-11)10-17-9-3-8-13(14,15)16/h4-7,17H,2-3,8-10H2,1H3 |
| InChIKey | YHHTXEILEWQWBL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|