C11H14BrF3N2 — CID 115520249
3-bromo-5-[(4,4,4-trifluorobutylamino)methyl]aniline (PubChem CID 115520249) has the molecular formula C11H14BrF3N2 and a molecular weight of 311.14 g/mol. Its IUPAC name is 3-bromo-5-[(4,4,4-trifluorobutylamino)methyl]aniline.
| Compound Name | 3-bromo-5-[(4,4,4-trifluorobutylamino)methyl]aniline |
|---|---|
| PubChem CID | 115520249 |
| Molecular Formula | C11H14BrF3N2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-bromo-5-[(4,4,4-trifluorobutylamino)methyl]aniline |
| SMILES | Nc1cc(Br)cc(CNCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14BrF3N2/c12-9-4-8(5-10(16)6-9)7-17-3-1-2-11(13,14)15/h4-6,17H,1-3,7,16H2 |
| InChIKey | GCYDQNKYBKRSDM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|