About 3-bromo-5-(2,2,2-trifluoroethyl)aniline
3-bromo-5-(2,2,2-trifluoroethyl)aniline (PubChem CID 20616110) has the molecular formula C8H7BrF3N
and a molecular weight of 254.05 g/mol. Its IUPAC name is 3-bromo-5-(2,2,2-trifluoroethyl)aniline.
Molecular Properties
| Compound Name | 3-bromo-5-(2,2,2-trifluoroethyl)aniline |
| PubChem CID | 20616110 |
| Molecular Formula | C8H7BrF3N |
| Molecular Weight | 254.05 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 3-bromo-5-(2,2,2-trifluoroethyl)aniline |
| SMILES | Nc1cc(Br)cc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C8H7BrF3N/c9-6-1-5(2-7(13)3-6)4-8(10,11)12/h1-3H,4,13H2 |
| InChIKey | YCOPMWCNHWMHGD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.05 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-(2,2,2-trifluoroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(2,2,2-trifluoroethyl)aniline?
The IUPAC name of 3-bromo-5-(2,2,2-trifluoroethyl)aniline (CID 20616110) is 3-bromo-5-(2,2,2-trifluoroethyl)aniline.
What is the SMILES notation for 3-bromo-5-(2,2,2-trifluoroethyl)aniline?
The canonical SMILES for 3-bromo-5-(2,2,2-trifluoroethyl)aniline is Nc1cc(Br)cc(CC(F)(F)F)c1.
What is the InChIKey of 3-bromo-5-(2,2,2-trifluoroethyl)aniline?
The InChIKey is YCOPMWCNHWMHGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrF3N/c9-6-1-5(2-7(13)3-6)4-8(10,11)12/h1-3H,4,13H2.
What are the key properties of 3-bromo-5-(2,2,2-trifluoroethyl)aniline?
3-bromo-5-(2,2,2-trifluoroethyl)aniline has a molecular weight of 254.05 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(2,2,2-trifluoroethyl)aniline is sourced from PubChem (CID 20616110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).