C12H17BrN2 — CID 115297673
4-bromo-3-[[(2,2-dimethylcyclopropyl)amino]methyl]aniline (PubChem CID 115297673) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 4-bromo-3-[[(2,2-dimethylcyclopropyl)amino]methyl]aniline.
| Compound Name | 4-bromo-3-[[(2,2-dimethylcyclopropyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 115297673 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-bromo-3-[[(2,2-dimethylcyclopropyl)amino]methyl]aniline |
| SMILES | CC1(C)CC1NCc1cc(N)ccc1Br |
| InChI | InChI=1S/C12H17BrN2/c1-12(2)6-11(12)15-7-8-5-9(14)3-4-10(8)13/h3-5,11,15H,6-7,14H2,1-2H3 |
| InChIKey | AFMOMBJLVGUYAP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|